600*400mm tunnel size luggage scanner machines. Guangdong baggage x-ray machine

General Specification
Tunnel Size: 615(W)*418(H)mm
Conveyor Speed: 0.23m/s
Conveyor Max Load: 170kg
Dose per Inspection <1.4Gy/h
Resolution < 0.0787mm Copper Wire
Spatial Resolution Level: Dia1.0mm
Vertical: Dial1.0mm
Penetrate resolution: Dia 0.254mm
Penetration: 40mm Steel
Film Safety Guarantee ISO1600 Film
X-ray Leakage: <0.1 Gy/h (at a distance of 5cm From external housing)
-----------------------------------------------------------------------------------------------------------------------------------------

X-ray Generator
Generate direct: Upward
Generate anger: 80 degree
Anode Voltage: 140~160Kv
Anode power: 0.4 to 1.2mA
Cooling / Duty Cycle: Oil Cooling /100%
-------------------------------------------------------------------------------------------------------------------------------------------

Image System
X-ray Sensor: L-Shaped Photodiode Array (multi-energetic), 12bit Deep
Monitor: High Resolution Color, LCD Accord, 17 inch
Image Processing: Edge enhancement, image strengthening, image lightening, , reducing darkening, image returning, image retrieval.
Image Grey Level: 4096
Image Max Resolution: 1024 * 1280 pixel
Image Processing: 24bit for processing real time
Image storage: Storage 60000 pictures in real time
Zoom: 2, 4, 8, 16 Times Enlarge, Whole screen continuous observation
Multi-energetic distinguish objects: Organic objects in orange, inorganic objects in blue, mixture in green
High-energy/low energy: Switch from high energy to low energy
Assist to detect drug and explosive powder
------------------------------------------------------------------------------------------------------------------------------------------

Installation Data
Operation temperature/Humidity: 0 C-45 C/20%-95%(non-condensing)
Storage Temperature/Humidity: -20 C-60 C/20%-95%(non-condensing)
Operation Power: 220VAC( 10%)50 3Hz
Power Consumption: 1.0 KW (max), 0.7KW(working)
Noise: <58dB.
--------------------------------------------------------------------------------------------------------------------------------------------

Computer Specs:

1. 1. CPU: Intl Core 2 Duo 3400, 2.6GHz, 1MB, L2 Cache and 800Mhz FSB
2. 2. Motherboards: Intel G41/Nvidia chip set, 7025 or better on OEM motherboard
3. 3. Bus architecture: Integrated Graphics,5PCI, 1PCI Express *1 and 1PCI BX press *16
4. 4. Memory: 2GB 1333MHz DDR3 RAM, with Minimum2 total DIMM slots.
5. 5. Hard Disk drive: 500GB 7200 rpm serial ATA HDD.
6. 6. Mouse: Optical
7. 7. Bays: 4 nos (2 nos, 5.25 inches for optical media drives and 2 nus 3.5 inches for hard disk drives)
8. 8. Ports: 6USB ports (with at least 2 in front), 1 serial port, parallel port, 1 ps/2 key board and 1 ps2 mouse port, audio ports for microphone and headphone in front.
9. 9. Cabinet: Mini Tower
10. 10. DMI: DMI 2.0 compliance and support.
11. 11. CD-R/RW Drive: CD Writer
12. 12. Networking facility: 10/100/1000 on board integrated network port with remote booting facility remote system installation, remote wake up, out of bad management using any standard management software.
13. 13. Operating System: Windows XP, Business reloaded with Media and documentation and certification of authenticity
14. 14. OD Certification: Win Logo Vista Business OS/Windows XP and Linux Certifications.
15. 15. Power Management: Screen blanking, hard disk and system idle mode in power on, set up password, power supply SMPS surge protected
16. 16. Preloaded software: Norton, MCAfee, E-trust of equivalent Antivirus (latest version) with one year license.